C17H26N2O3 — CID 122002181
3-[(2,2-dimethyl-5-phenylpentyl)carbamoylamino]propanoic acid (PubChem CID 122002181) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-5-phenylpentyl)carbamoylamino]propanoic acid.
| Compound Name | 3-[(2,2-dimethyl-5-phenylpentyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122002181 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 3-[(2,2-dimethyl-5-phenylpentyl)carbamoylamino]propanoic acid |
| SMILES | CC(C)(CCCc1ccccc1)CNC(=O)NCCC(=O)O |
| InChI | InChI=1S/C17H26N2O3/c1-17(2,11-6-9-14-7-4-3-5-8-14)13-19-16(22)18-12-10-15(20)21/h3-5,7-8H,6,9-13H2,1-2H3,(H,20,21)(H2,18,19,22) |
| InChIKey | HAGOBDYMMNJOQD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |