C23H28N2O4 — CID 119222892
3-[[4-[(2,2-dimethyl-5-phenylpentanoyl)amino]benzoyl]amino]propanoic acid (PubChem CID 119222892) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-[[4-[(2,2-dimethyl-5-phenylpentanoyl)amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(2,2-dimethyl-5-phenylpentanoyl)amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119222892 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-[[4-[(2,2-dimethyl-5-phenylpentanoyl)amino]benzoyl]amino]propanoic acid |
| SMILES | CC(C)(CCCc1ccccc1)C(=O)Nc1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-23(2,15-6-9-17-7-4-3-5-8-17)22(29)25-19-12-10-18(11-13-19)21(28)24-16-14-20(26)27/h3-5,7-8,10-13H,6,9,14-16H2,1-2H3,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | GMLZBTZWFURTKB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |