C26H29N2O7P — CID 70053893
3-[[(2S)-2-[4-methoxy-N-(phosphonomethyl)anilino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid (PubChem CID 70053893) has the molecular formula C26H29N2O7P and a molecular weight of 512.50 g/mol. Its IUPAC name is 3-[[(2S)-2-[4-methoxy-N-(phosphonomethyl)anilino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid.
| Compound Name | 3-[[(2S)-2-[4-methoxy-N-(phosphonomethyl)anilino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70053893 |
| Molecular Formula | C26H29N2O7P |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 3-[[(2S)-2-[4-methoxy-N-(phosphonomethyl)anilino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid |
| SMILES | COc1ccc(N(CP(=O)(O)O)[C@@H](Cc2ccc(-c3ccccc3)cc2)C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C26H29N2O7P/c1-35-23-13-11-22(12-14-23)28(18-36(32,33)34)24(26(31)27-16-15-25(29)30)17-19-7-9-21(10-8-19)20-5-3-2-4-6-20/h2-14,24H,15-18H2,1H3,(H,27,31)(H,29,30)(H2,32,33,34)/t24-/m0/s1 |
| InChIKey | GFUPQWLHNANBDD-DEOSSOPVSA-N |
| XLogP | 3.51 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|