C33H34N2O3 — CID 133214141
2-[benzyl(3-phenylpropanoyl)amino]-N-[(4-methoxyphenyl)methyl]-3-phenylpropanamide (PubChem CID 133214141) has the molecular formula C33H34N2O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-[benzyl(3-phenylpropanoyl)amino]-N-[(4-methoxyphenyl)methyl]-3-phenylpropanamide.
| Compound Name | 2-[benzyl(3-phenylpropanoyl)amino]-N-[(4-methoxyphenyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133214141 |
| Molecular Formula | C33H34N2O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 2-[benzyl(3-phenylpropanoyl)amino]-N-[(4-methoxyphenyl)methyl]-3-phenylpropanamide |
| SMILES | COc1ccc(CNC(=O)C(Cc2ccccc2)N(Cc2ccccc2)C(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H34N2O3/c1-38-30-20-17-28(18-21-30)24-34-33(37)31(23-27-13-7-3-8-14-27)35(25-29-15-9-4-10-16-29)32(36)22-19-26-11-5-2-6-12-26/h2-18,20-21,31H,19,22-25H2,1H3,(H,34,37) |
| InChIKey | MUXMYDIIZXDYDD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |