C31H31N3O2 — CID 133214149
2-[benzyl(3-phenylpropanoyl)amino]-3-phenyl-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 133214149) has the molecular formula C31H31N3O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 2-[benzyl(3-phenylpropanoyl)amino]-3-phenyl-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 2-[benzyl(3-phenylpropanoyl)amino]-3-phenyl-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 133214149 |
| Molecular Formula | C31H31N3O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 2-[benzyl(3-phenylpropanoyl)amino]-3-phenyl-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | O=C(NCc1ccncc1)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C31H31N3O2/c35-30(17-16-25-10-4-1-5-11-25)34(24-28-14-8-3-9-15-28)29(22-26-12-6-2-7-13-26)31(36)33-23-27-18-20-32-21-19-27/h1-15,18-21,29H,16-17,22-24H2,(H,33,36) |
| InChIKey | SRFZMXLBMFMKIH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |