C28H32NO7P — CID 54002645
benzyl 3-[[(2S)-2-[methoxy(2-phenylethoxy)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoate (PubChem CID 54002645) has the molecular formula C28H32NO7P and a molecular weight of 525.54 g/mol. Its IUPAC name is benzyl 3-[[(2S)-2-[methoxy(2-phenylethoxy)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoate.
| Compound Name | benzyl 3-[[(2S)-2-[methoxy(2-phenylethoxy)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoate |
|---|---|
| PubChem CID | 54002645 |
| Molecular Formula | C28H32NO7P |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | benzyl 3-[[(2S)-2-[methoxy(2-phenylethoxy)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoate |
| SMILES | COP(=O)(OCCc1ccccc1)O[C@@H](Cc1ccccc1)C(=O)NCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H32NO7P/c1-33-37(32,35-20-18-23-11-5-2-6-12-23)36-26(21-24-13-7-3-8-14-24)28(31)29-19-17-27(30)34-22-25-15-9-4-10-16-25/h2-16,26H,17-22H2,1H3,(H,29,31)/t26-,37?/m0/s1 |
| InChIKey | KMRPXOFNZOUKBH-XVNGORCSSA-N |
| XLogP | 4.88 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|