C21H23NO4 — CID 90334439
4-[[(2R)-1-carboxy-3-(4-phenylphenyl)propan-2-yl]amino]pent-4-enoic acid (PubChem CID 90334439) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 4-[[(2R)-1-carboxy-3-(4-phenylphenyl)propan-2-yl]amino]pent-4-enoic acid.
| Compound Name | 4-[[(2R)-1-carboxy-3-(4-phenylphenyl)propan-2-yl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 90334439 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-[[(2R)-1-carboxy-3-(4-phenylphenyl)propan-2-yl]amino]pent-4-enoic acid |
| SMILES | C=C(CCC(=O)O)N[C@@H](CC(=O)O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-15(7-12-20(23)24)22-19(14-21(25)26)13-16-8-10-18(11-9-16)17-5-3-2-4-6-17/h2-6,8-11,19,22H,1,7,12-14H2,(H,23,24)(H,25,26)/t19-/m1/s1 |
| InChIKey | TZPXCPVZCZUOJE-LJQANCHMSA-N |
| XLogP | 3.71 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |