C20H20ClNO5 — CID 59607602
4-[[(2R)-1-carboxy-3-[4-(2-chlorophenyl)phenyl]propan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 59607602) has the molecular formula C20H20ClNO5 and a molecular weight of 389.84 g/mol. Its IUPAC name is 4-[[(2R)-1-carboxy-3-[4-(2-chlorophenyl)phenyl]propan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2R)-1-carboxy-3-[4-(2-chlorophenyl)phenyl]propan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59607602 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 4-[[(2R)-1-carboxy-3-[4-(2-chlorophenyl)phenyl]propan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N[C@@H](CC(=O)O)Cc1ccc(-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H20ClNO5/c21-17-4-2-1-3-16(17)14-7-5-13(6-8-14)11-15(12-20(26)27)22-18(23)9-10-19(24)25/h1-8,15H,9-12H2,(H,22,23)(H,24,25)(H,26,27)/t15-/m1/s1 |
| InChIKey | XEOHSKRBTKLXRC-OAHLLOKOSA-N |
| XLogP | 3.37 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |