C23H27NO6 — CID 68752507
(2S)-4-(3-carboxypropanoylamino)-5-[4-(2-methoxyphenyl)phenyl]-2-methylpentanoic acid (PubChem CID 68752507) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (2S)-4-(3-carboxypropanoylamino)-5-[4-(2-methoxyphenyl)phenyl]-2-methylpentanoic acid.
| Compound Name | (2S)-4-(3-carboxypropanoylamino)-5-[4-(2-methoxyphenyl)phenyl]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 68752507 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (2S)-4-(3-carboxypropanoylamino)-5-[4-(2-methoxyphenyl)phenyl]-2-methylpentanoic acid |
| SMILES | COc1ccccc1-c1ccc(CC(C[C@H](C)C(=O)O)NC(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C23H27NO6/c1-15(23(28)29)13-18(24-21(25)11-12-22(26)27)14-16-7-9-17(10-8-16)19-5-3-4-6-20(19)30-2/h3-10,15,18H,11-14H2,1-2H3,(H,24,25)(H,26,27)(H,28,29)/t15-,18?/m0/s1 |
| InChIKey | ZCWJGYURZOYRDN-BUSXIPJBSA-N |
| XLogP | 3.37 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |