C17H17ClO2 — CID 82543182
4-[4-(2-chlorophenyl)phenyl]-3-methylbutanoic acid (PubChem CID 82543182) has the molecular formula C17H17ClO2 and a molecular weight of 288.77 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)phenyl]-3-methylbutanoic acid.
| Compound Name | 4-[4-(2-chlorophenyl)phenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 82543182 |
| Molecular Formula | C17H17ClO2 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-[4-(2-chlorophenyl)phenyl]-3-methylbutanoic acid |
| SMILES | CC(CC(=O)O)Cc1ccc(-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H17ClO2/c1-12(11-17(19)20)10-13-6-8-14(9-7-13)15-4-2-3-5-16(15)18/h2-9,12H,10-11H2,1H3,(H,19,20) |
| InChIKey | NNJZROYTMTXXKG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |