C16H15ClO4S — CID 21496294
2-[1-[4-(2-chlorophenyl)phenyl]ethylsulfonyl]acetic acid (PubChem CID 21496294) has the molecular formula C16H15ClO4S and a molecular weight of 338.81 g/mol. Its IUPAC name is 2-[1-[4-(2-chlorophenyl)phenyl]ethylsulfonyl]acetic acid.
| Compound Name | 2-[1-[4-(2-chlorophenyl)phenyl]ethylsulfonyl]acetic acid |
|---|---|
| PubChem CID | 21496294 |
| Molecular Formula | C16H15ClO4S |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 2-[1-[4-(2-chlorophenyl)phenyl]ethylsulfonyl]acetic acid |
| SMILES | CC(c1ccc(-c2ccccc2Cl)cc1)S(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C16H15ClO4S/c1-11(22(20,21)10-16(18)19)12-6-8-13(9-7-12)14-4-2-3-5-15(14)17/h2-9,11H,10H2,1H3,(H,18,19) |
| InChIKey | YVUQKQDPSQFEDS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |