C17H16ClNO3S — CID 54353825
2-[4-(2-chlorophenyl)phenyl]-2-(ethylcarbamoylsulfanyl)acetic acid (PubChem CID 54353825) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)phenyl]-2-(ethylcarbamoylsulfanyl)acetic acid.
| Compound Name | 2-[4-(2-chlorophenyl)phenyl]-2-(ethylcarbamoylsulfanyl)acetic acid |
|---|---|
| PubChem CID | 54353825 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-[4-(2-chlorophenyl)phenyl]-2-(ethylcarbamoylsulfanyl)acetic acid |
| SMILES | CCNC(=O)SC(C(=O)O)c1ccc(-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO3S/c1-2-19-17(22)23-15(16(20)21)12-9-7-11(8-10-12)13-5-3-4-6-14(13)18/h3-10,15H,2H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | UHROOROPTWOCLJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|