C15H22F3NO — CID 143712310
ethane;1-[3-methyl-5-(trifluoromethyl)phenyl]piperidin-4-ol (PubChem CID 143712310) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is ethane;1-[3-methyl-5-(trifluoromethyl)phenyl]piperidin-4-ol.
| Compound Name | ethane;1-[3-methyl-5-(trifluoromethyl)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 143712310 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethane;1-[3-methyl-5-(trifluoromethyl)phenyl]piperidin-4-ol |
| SMILES | CC.Cc1cc(N2CCC(O)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO.C2H6/c1-9-6-10(13(14,15)16)8-11(7-9)17-4-2-12(18)3-5-17;1-2/h6-8,12,18H,2-5H2,1H3;1-2H3 |
| InChIKey | GEARJOPSUBVGPJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |