C17H23F3N2 — CID 58366312
1-cyclopentyl-4-[3-methyl-5-(trifluoromethyl)phenyl]piperazine (PubChem CID 58366312) has the molecular formula C17H23F3N2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-cyclopentyl-4-[3-methyl-5-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-cyclopentyl-4-[3-methyl-5-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 58366312 |
| Molecular Formula | C17H23F3N2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-cyclopentyl-4-[3-methyl-5-(trifluoromethyl)phenyl]piperazine |
| SMILES | Cc1cc(N2CCN(C3CCCC3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3N2/c1-13-10-14(17(18,19)20)12-16(11-13)22-8-6-21(7-9-22)15-4-2-3-5-15/h10-12,15H,2-9H2,1H3 |
| InChIKey | AUYVPRDXXZYVRY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |