C17H21F3N2O2 — CID 58305493
3-(4-pyrrolidin-1-ylpiperidin-1-yl)-5-(trifluoromethyl)benzoic acid (PubChem CID 58305493) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 3-(4-pyrrolidin-1-ylpiperidin-1-yl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(4-pyrrolidin-1-ylpiperidin-1-yl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 58305493 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-(4-pyrrolidin-1-ylpiperidin-1-yl)-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(N2CCC(N3CCCC3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F3N2O2/c18-17(19,20)13-9-12(16(23)24)10-15(11-13)22-7-3-14(4-8-22)21-5-1-2-6-21/h9-11,14H,1-8H2,(H,23,24) |
| InChIKey | FEHJRQMCIAUKMO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |