C12H12F3NO2S — CID 137353606
3-thiomorpholin-4-yl-5-(trifluoromethyl)benzoic acid (PubChem CID 137353606) has the molecular formula C12H12F3NO2S and a molecular weight of 291.29 g/mol. Its IUPAC name is 3-thiomorpholin-4-yl-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-thiomorpholin-4-yl-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 137353606 |
| Molecular Formula | C12H12F3NO2S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 3-thiomorpholin-4-yl-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(N2CCSCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3NO2S/c13-12(14,15)9-5-8(11(17)18)6-10(7-9)16-1-3-19-4-2-16/h5-7H,1-4H2,(H,17,18) |
| InChIKey | LJBRUJKUUWMSDU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |