C15H19F3N2O2 — CID 155804240
3-(4-propan-2-ylpiperazin-1-yl)-5-(trifluoromethyl)benzoic acid (PubChem CID 155804240) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 3-(4-propan-2-ylpiperazin-1-yl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(4-propan-2-ylpiperazin-1-yl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 155804240 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-(4-propan-2-ylpiperazin-1-yl)-5-(trifluoromethyl)benzoic acid |
| SMILES | CC(C)N1CCN(c2cc(C(=O)O)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-10(2)19-3-5-20(6-4-19)13-8-11(14(21)22)7-12(9-13)15(16,17)18/h7-10H,3-6H2,1-2H3,(H,21,22) |
| InChIKey | XVSMTSIZWIILQX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |