C11H9NO3 — CID 42544346
methyl (2R,3S)-3-(4-cyanophenyl)oxirane-2-carboxylate (PubChem CID 42544346) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is methyl (2R,3S)-3-(4-cyanophenyl)oxirane-2-carboxylate.
| Compound Name | methyl (2R,3S)-3-(4-cyanophenyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 42544346 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | methyl (2R,3S)-3-(4-cyanophenyl)oxirane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H]1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C11H9NO3/c1-14-11(13)10-9(15-10)8-4-2-7(6-12)3-5-8/h2-5,9-10H,1H3/t9-,10+/m0/s1 |
| InChIKey | BGZXIMFTXAMVRB-VHSXEESVSA-N |
| XLogP | 1.17 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|