C10H9FO3 — CID 95212361
methyl (2S,3R)-3-(3-fluorophenyl)oxirane-2-carboxylate (PubChem CID 95212361) has the molecular formula C10H9FO3 and a molecular weight of 196.18 g/mol. Its IUPAC name is methyl (2S,3R)-3-(3-fluorophenyl)oxirane-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-(3-fluorophenyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 95212361 |
| Molecular Formula | C10H9FO3 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | methyl (2S,3R)-3-(3-fluorophenyl)oxirane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C10H9FO3/c1-13-10(12)9-8(14-9)6-3-2-4-7(11)5-6/h2-5,8-9H,1H3/t8-,9+/m1/s1 |
| InChIKey | PIHQFYWGMXPPLZ-BDAKNGLRSA-N |
| XLogP | 1.44 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|