C9H7FO3 — CID 95212331
(2R,3R)-3-(3-fluorophenyl)oxirane-2-carboxylic acid (PubChem CID 95212331) has the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. Its IUPAC name is (2R,3R)-3-(3-fluorophenyl)oxirane-2-carboxylic acid.
| Compound Name | (2R,3R)-3-(3-fluorophenyl)oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 95212331 |
| Molecular Formula | C9H7FO3 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | (2R,3R)-3-(3-fluorophenyl)oxirane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1O[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C9H7FO3/c10-6-3-1-2-5(4-6)7-8(13-7)9(11)12/h1-4,7-8H,(H,11,12)/t7-,8-/m1/s1 |
| InChIKey | HVZSTHNSMLBPRD-HTQZYQBOSA-N |
| XLogP | 1.35 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|