C20H20N2O3 — CID 16732228
4-[(2R,3R)-3-[(1S)-1-(4-methoxyanilino)-3-oxobutyl]oxiran-2-yl]benzonitrile (PubChem CID 16732228) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[(2R,3R)-3-[(1S)-1-(4-methoxyanilino)-3-oxobutyl]oxiran-2-yl]benzonitrile.
| Compound Name | 4-[(2R,3R)-3-[(1S)-1-(4-methoxyanilino)-3-oxobutyl]oxiran-2-yl]benzonitrile |
|---|---|
| PubChem CID | 16732228 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-[(2R,3R)-3-[(1S)-1-(4-methoxyanilino)-3-oxobutyl]oxiran-2-yl]benzonitrile |
| SMILES | COc1ccc(N[C@@H](CC(C)=O)[C@H]2O[C@@H]2c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O3/c1-13(23)11-18(22-16-7-9-17(24-2)10-8-16)20-19(25-20)15-5-3-14(12-21)4-6-15/h3-10,18-20,22H,11H2,1-2H3/t18-,19+,20+/m0/s1 |
| InChIKey | VWWFDRVGCFQSIA-XUVXKRRUSA-N |
| XLogP | 3.47 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|