C20H19N3O3 — CID 108976395
1-N'-(4-cyanophenyl)-1-N-[(4-methoxyphenyl)methyl]cyclopropane-1,1-dicarboxamide (PubChem CID 108976395) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-N'-(4-cyanophenyl)-1-N-[(4-methoxyphenyl)methyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-cyanophenyl)-1-N-[(4-methoxyphenyl)methyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976395 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-N'-(4-cyanophenyl)-1-N-[(4-methoxyphenyl)methyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(CNC(=O)C2(C(=O)Nc3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H19N3O3/c1-26-17-8-4-15(5-9-17)13-22-18(24)20(10-11-20)19(25)23-16-6-2-14(12-21)3-7-16/h2-9H,10-11,13H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | HEJGXXJTWJBUCL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|