C19H20N2O3 — CID 108976318
1-N-[(4-methoxyphenyl)methyl]-1-N'-phenylcyclopropane-1,1-dicarboxamide (PubChem CID 108976318) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-N-[(4-methoxyphenyl)methyl]-1-N'-phenylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[(4-methoxyphenyl)methyl]-1-N'-phenylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976318 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-N-[(4-methoxyphenyl)methyl]-1-N'-phenylcyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(CNC(=O)C2(C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-24-16-9-7-14(8-10-16)13-20-17(22)19(11-12-19)18(23)21-15-5-3-2-4-6-15/h2-10H,11-13H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | GROOWLBIRDOPQQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|