C21H22N2O5 — CID 108976373
methyl 2-[[1-[(4-methoxyphenyl)methylcarbamoyl]cyclopropanecarbonyl]amino]benzoate (PubChem CID 108976373) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl 2-[[1-[(4-methoxyphenyl)methylcarbamoyl]cyclopropanecarbonyl]amino]benzoate.
| Compound Name | methyl 2-[[1-[(4-methoxyphenyl)methylcarbamoyl]cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 108976373 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | methyl 2-[[1-[(4-methoxyphenyl)methylcarbamoyl]cyclopropanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1(C(=O)NCc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C21H22N2O5/c1-27-15-9-7-14(8-10-15)13-22-19(25)21(11-12-21)20(26)23-17-6-4-3-5-16(17)18(24)28-2/h3-10H,11-13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | XUEQWYSSVQCZBZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|