C25H31NO6 — CID 66916373
benzyl 4-acetyl-5-[4-methoxy-3-(3-methoxypropoxy)phenyl]pyrrolidine-2-carboxylate (PubChem CID 66916373) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is benzyl 4-acetyl-5-[4-methoxy-3-(3-methoxypropoxy)phenyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl 4-acetyl-5-[4-methoxy-3-(3-methoxypropoxy)phenyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 66916373 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | benzyl 4-acetyl-5-[4-methoxy-3-(3-methoxypropoxy)phenyl]pyrrolidine-2-carboxylate |
| SMILES | COCCCOc1cc(C2NC(C(=O)OCc3ccccc3)CC2C(C)=O)ccc1OC |
| InChI | InChI=1S/C25H31NO6/c1-17(27)20-15-21(25(28)32-16-18-8-5-4-6-9-18)26-24(20)19-10-11-22(30-3)23(14-19)31-13-7-12-29-2/h4-6,8-11,14,20-21,24,26H,7,12-13,15-16H2,1-3H3 |
| InChIKey | OBIXKODQHXZUSW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|