C18H25NO6 — CID 69255755
(2R,4R,5S)-4-acetyl-5-[4-methoxy-3-(3-methoxypropoxy)phenyl]pyrrolidine-2-carboxylic acid (PubChem CID 69255755) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is (2R,4R,5S)-4-acetyl-5-[4-methoxy-3-(3-methoxypropoxy)phenyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4R,5S)-4-acetyl-5-[4-methoxy-3-(3-methoxypropoxy)phenyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 69255755 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (2R,4R,5S)-4-acetyl-5-[4-methoxy-3-(3-methoxypropoxy)phenyl]pyrrolidine-2-carboxylic acid |
| SMILES | COCCCOc1cc([C@H]2N[C@@H](C(=O)O)C[C@H]2C(C)=O)ccc1OC |
| InChI | InChI=1S/C18H25NO6/c1-11(20)13-10-14(18(21)22)19-17(13)12-5-6-15(24-3)16(9-12)25-8-4-7-23-2/h5-6,9,13-14,17,19H,4,7-8,10H2,1-3H3,(H,21,22)/t13-,14+,17+/m0/s1 |
| InChIKey | VWABTRZTKMUFJX-JJRVBVJISA-N |
| XLogP | 1.80 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|