C17H22N2O7 — CID 101070020
ethyl (2R,4R,5S)-4-acetyl-5-(4,5-dimethoxy-2-nitrophenyl)pyrrolidine-2-carboxylate (PubChem CID 101070020) has the molecular formula C17H22N2O7 and a molecular weight of 366.37 g/mol. Its IUPAC name is ethyl (2R,4R,5S)-4-acetyl-5-(4,5-dimethoxy-2-nitrophenyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2R,4R,5S)-4-acetyl-5-(4,5-dimethoxy-2-nitrophenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 101070020 |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | ethyl (2R,4R,5S)-4-acetyl-5-(4,5-dimethoxy-2-nitrophenyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](C(C)=O)[C@@H](c2cc(OC)c(OC)cc2[N+](=O)[O-])N1 |
| InChI | InChI=1S/C17H22N2O7/c1-5-26-17(21)12-6-10(9(2)20)16(18-12)11-7-14(24-3)15(25-4)8-13(11)19(22)23/h7-8,10,12,16,18H,5-6H2,1-4H3/t10-,12+,16-/m0/s1 |
| InChIKey | KVCBLGMHUFTNOS-IETSOEAISA-N |
| XLogP | 1.78 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|