C13H15NO9S — CID 42625095
ethyl (4R,5S)-5-(4,5-dimethoxy-2-nitrophenyl)-2-oxo-1,3,2-dioxathiolane-4-carboxylate (PubChem CID 42625095) has the molecular formula C13H15NO9S and a molecular weight of 361.33 g/mol. Its IUPAC name is ethyl (4R,5S)-5-(4,5-dimethoxy-2-nitrophenyl)-2-oxo-1,3,2-dioxathiolane-4-carboxylate.
| Compound Name | ethyl (4R,5S)-5-(4,5-dimethoxy-2-nitrophenyl)-2-oxo-1,3,2-dioxathiolane-4-carboxylate |
|---|---|
| PubChem CID | 42625095 |
| Molecular Formula | C13H15NO9S |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | ethyl (4R,5S)-5-(4,5-dimethoxy-2-nitrophenyl)-2-oxo-1,3,2-dioxathiolane-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1OS(=O)O[C@H]1c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15NO9S/c1-4-21-13(15)12-11(22-24(18)23-12)7-5-9(19-2)10(20-3)6-8(7)14(16)17/h5-6,11-12H,4H2,1-3H3/t11-,12+,24?/m0/s1 |
| InChIKey | DSIQOGJRSDWYIF-IGMSCZMFSA-N |
| XLogP | 1.21 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|