C14H15NO7 — CID 15672998
ethyl 4-(4,5-dimethoxy-2-nitrophenyl)-4-hydroxybut-2-ynoate (PubChem CID 15672998) has the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. Its IUPAC name is ethyl 4-(4,5-dimethoxy-2-nitrophenyl)-4-hydroxybut-2-ynoate.
| Compound Name | ethyl 4-(4,5-dimethoxy-2-nitrophenyl)-4-hydroxybut-2-ynoate |
|---|---|
| PubChem CID | 15672998 |
| Molecular Formula | C14H15NO7 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | ethyl 4-(4,5-dimethoxy-2-nitrophenyl)-4-hydroxybut-2-ynoate |
| SMILES | CCOC(=O)C#CC(O)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15NO7/c1-4-22-14(17)6-5-11(16)9-7-12(20-2)13(21-3)8-10(9)15(18)19/h7-8,11,16H,4H2,1-3H3 |
| InChIKey | DWZQMVJHDQPVSG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|