C13H11NO7 — CID 18697784
ethyl 4-hydroxy-4-(6-nitro-1,3-benzodioxol-5-yl)but-2-ynoate (PubChem CID 18697784) has the molecular formula C13H11NO7 and a molecular weight of 293.23 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-(6-nitro-1,3-benzodioxol-5-yl)but-2-ynoate.
| Compound Name | ethyl 4-hydroxy-4-(6-nitro-1,3-benzodioxol-5-yl)but-2-ynoate |
|---|---|
| PubChem CID | 18697784 |
| Molecular Formula | C13H11NO7 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | ethyl 4-hydroxy-4-(6-nitro-1,3-benzodioxol-5-yl)but-2-ynoate |
| SMILES | CCOC(=O)C#CC(O)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C13H11NO7/c1-2-19-13(16)4-3-10(15)8-5-11-12(21-7-20-11)6-9(8)14(17)18/h5-6,10,15H,2,7H2,1H3 |
| InChIKey | XWZYSLIGNDDLQR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|