C14H16O6 — CID 139835190
ethyl 6,7-dimethoxy-4-oxo-1H-isochromene-1-carboxylate (PubChem CID 139835190) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is ethyl 6,7-dimethoxy-4-oxo-1H-isochromene-1-carboxylate.
| Compound Name | ethyl 6,7-dimethoxy-4-oxo-1H-isochromene-1-carboxylate |
|---|---|
| PubChem CID | 139835190 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | ethyl 6,7-dimethoxy-4-oxo-1H-isochromene-1-carboxylate |
| SMILES | CCOC(=O)C1OCC(=O)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C14H16O6/c1-4-19-14(16)13-9-6-12(18-3)11(17-2)5-8(9)10(15)7-20-13/h5-6,13H,4,7H2,1-3H3 |
| InChIKey | JFTSBLJXYROKOS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |