C17H20N2O8 — CID 101070027
diethyl (2R,4R,5S)-5-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidine-2,4-dicarboxylate (PubChem CID 101070027) has the molecular formula C17H20N2O8 and a molecular weight of 380.35 g/mol. Its IUPAC name is diethyl (2R,4R,5S)-5-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidine-2,4-dicarboxylate.
| Compound Name | diethyl (2R,4R,5S)-5-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 101070027 |
| Molecular Formula | C17H20N2O8 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | diethyl (2R,4R,5S)-5-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](C(=O)OCC)[C@@H](c2cc3c(cc2[N+](=O)[O-])OCO3)N1 |
| InChI | InChI=1S/C17H20N2O8/c1-3-24-16(20)10-5-11(17(21)25-4-2)18-15(10)9-6-13-14(27-8-26-13)7-12(9)19(22)23/h6-7,10-11,15,18H,3-5,8H2,1-2H3/t10-,11-,15-/m1/s1 |
| InChIKey | SGFVQVMGJSCLCV-UEKVPHQBSA-N |
| XLogP | 1.47 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|