C19H24BO2- — CID 122363453
2-benzyl-4,4,5,5-tetramethyl-2-phenyl-1,3-dioxa-2-boranuidacyclopentane (PubChem CID 122363453) has the molecular formula C19H24BO2- and a molecular weight of 295.21 g/mol. Its IUPAC name is 2-benzyl-4,4,5,5-tetramethyl-2-phenyl-1,3-dioxa-2-boranuidacyclopentane.
| Compound Name | 2-benzyl-4,4,5,5-tetramethyl-2-phenyl-1,3-dioxa-2-boranuidacyclopentane |
|---|---|
| PubChem CID | 122363453 |
| Molecular Formula | C19H24BO2- |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-benzyl-4,4,5,5-tetramethyl-2-phenyl-1,3-dioxa-2-boranuidacyclopentane |
| SMILES | CC1(C)O[B-](Cc2ccccc2)(c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C19H24BO2/c1-18(2)19(3,4)22-20(21-18,17-13-9-6-10-14-17)15-16-11-7-5-8-12-16/h5-14H,15H2,1-4H3/q-1 |
| InChIKey | XJXQQBZHPCSDER-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|