C26H29BBrO3- — CID 135048698
2-(bromomethyl)-4,4,5,5-tetramethyl-2-trityloxy-1,3-dioxa-2-boranuidacyclopentane (PubChem CID 135048698) has the molecular formula C26H29BBrO3- and a molecular weight of 480.23 g/mol. Its IUPAC name is 2-(bromomethyl)-4,4,5,5-tetramethyl-2-trityloxy-1,3-dioxa-2-boranuidacyclopentane.
| Compound Name | 2-(bromomethyl)-4,4,5,5-tetramethyl-2-trityloxy-1,3-dioxa-2-boranuidacyclopentane |
|---|---|
| PubChem CID | 135048698 |
| Molecular Formula | C26H29BBrO3- |
| Molecular Weight | 480.23 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 2-(bromomethyl)-4,4,5,5-tetramethyl-2-trityloxy-1,3-dioxa-2-boranuidacyclopentane |
| SMILES | CC1(C)O[B-](CBr)(OC(c2ccccc2)(c2ccccc2)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C26H29BBrO3/c1-24(2)25(3,4)30-27(20-28,29-24)31-26(21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-19H,20H2,1-4H3/q-1 |
| InChIKey | AQMOSOPOKJWBHV-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.23 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|