C21H20BCl2O4- — CID 135062147
8,9-bis(4-chlorophenyl)-2,2,3,3-tetramethyl-1,4,6-trioxa-5-boranuidaspiro[4.4]non-8-en-7-one (PubChem CID 135062147) has the molecular formula C21H20BCl2O4- and a molecular weight of 418.11 g/mol. Its IUPAC name is 8,9-bis(4-chlorophenyl)-2,2,3,3-tetramethyl-1,4,6-trioxa-5-boranuidaspiro[4.4]non-8-en-7-one.
| Compound Name | 8,9-bis(4-chlorophenyl)-2,2,3,3-tetramethyl-1,4,6-trioxa-5-boranuidaspiro[4.4]non-8-en-7-one |
|---|---|
| PubChem CID | 135062147 |
| Molecular Formula | C21H20BCl2O4- |
| Molecular Weight | 418.11 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 8,9-bis(4-chlorophenyl)-2,2,3,3-tetramethyl-1,4,6-trioxa-5-boranuidaspiro[4.4]non-8-en-7-one |
| SMILES | CC1(C)O[B-]2(OC(=O)C(c3ccc(Cl)cc3)=C2c2ccc(Cl)cc2)OC1(C)C |
| InChI | InChI=1S/C21H20BCl2O4/c1-20(2)21(3,4)28-22(27-20)18(14-7-11-16(24)12-8-14)17(19(25)26-22)13-5-9-15(23)10-6-13/h5-12H,1-4H3/q-1 |
| InChIKey | HDUOXEYHXCANCG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.11 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|