C18H8Cl2O4 — CID 12695053
1,4-bis(4-chlorophenyl)furo[3,4-c]furan-3,6-dione (PubChem CID 12695053) has the molecular formula C18H8Cl2O4 and a molecular weight of 359.16 g/mol. Its IUPAC name is 1,4-bis(4-chlorophenyl)furo[3,4-c]furan-3,6-dione.
| Compound Name | 1,4-bis(4-chlorophenyl)furo[3,4-c]furan-3,6-dione |
|---|---|
| PubChem CID | 12695053 |
| Molecular Formula | C18H8Cl2O4 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 1,4-bis(4-chlorophenyl)furo[3,4-c]furan-3,6-dione |
| SMILES | O=C1OC(c2ccc(Cl)cc2)=C2C(=O)OC(c3ccc(Cl)cc3)=C12 |
| InChI | InChI=1S/C18H8Cl2O4/c19-11-5-1-9(2-6-11)15-13-14(18(22)23-15)16(24-17(13)21)10-3-7-12(20)8-4-10/h1-8H |
| InChIKey | NBHQFQZPDVEFHP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|