C16H7ClN2O4 — CID 57144913
3-(2,1,3-benzoxadiazol-5-yl)-4-(4-chlorophenyl)furan-2,5-dione (PubChem CID 57144913) has the molecular formula C16H7ClN2O4 and a molecular weight of 326.70 g/mol. Its IUPAC name is 3-(2,1,3-benzoxadiazol-5-yl)-4-(4-chlorophenyl)furan-2,5-dione.
| Compound Name | 3-(2,1,3-benzoxadiazol-5-yl)-4-(4-chlorophenyl)furan-2,5-dione |
|---|---|
| PubChem CID | 57144913 |
| Molecular Formula | C16H7ClN2O4 |
| Molecular Weight | 326.70 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 3-(2,1,3-benzoxadiazol-5-yl)-4-(4-chlorophenyl)furan-2,5-dione |
| SMILES | O=C1OC(=O)C(c2ccc3nonc3c2)=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H7ClN2O4/c17-10-4-1-8(2-5-10)13-14(16(21)22-15(13)20)9-3-6-11-12(7-9)19-23-18-11/h1-7H |
| InChIKey | HSQNWXISPFJLDM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.70 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|