C11H7ClO4 — CID 13308165
4-chloro-5-(4-methoxyphenyl)furan-2,3-dione (PubChem CID 13308165) has the molecular formula C11H7ClO4 and a molecular weight of 238.63 g/mol. Its IUPAC name is 4-chloro-5-(4-methoxyphenyl)furan-2,3-dione.
| Compound Name | 4-chloro-5-(4-methoxyphenyl)furan-2,3-dione |
|---|---|
| PubChem CID | 13308165 |
| Molecular Formula | C11H7ClO4 |
| Molecular Weight | 238.63 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 4-chloro-5-(4-methoxyphenyl)furan-2,3-dione |
| SMILES | COc1ccc(C2=C(Cl)C(=O)C(=O)O2)cc1 |
| InChI | InChI=1S/C11H7ClO4/c1-15-7-4-2-6(3-5-7)10-8(12)9(13)11(14)16-10/h2-5H,1H3 |
| InChIKey | LVZBFLZFGMWVKF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.63 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|