C12H10ClNO3S — CID 4120941
2-(4-chlorophenyl)-5-(dimethyl-λ4-sulfanylidene)-1,3-oxazine-4,6-dione (PubChem CID 4120941) has the molecular formula C12H10ClNO3S and a molecular weight of 283.74 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-(dimethyl-λ4-sulfanylidene)-1,3-oxazine-4,6-dione.
| Compound Name | 2-(4-chlorophenyl)-5-(dimethyl-λ4-sulfanylidene)-1,3-oxazine-4,6-dione |
|---|---|
| PubChem CID | 4120941 |
| Molecular Formula | C12H10ClNO3S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 2-(4-chlorophenyl)-5-(dimethyl-λ4-sulfanylidene)-1,3-oxazine-4,6-dione |
| SMILES | CS(C)=C1C(=O)N=C(c2ccc(Cl)cc2)OC1=O |
| InChI | InChI=1S/C12H10ClNO3S/c1-18(2)9-10(15)14-11(17-12(9)16)7-3-5-8(13)6-4-7/h3-6H,1-2H3 |
| InChIKey | PWTNTZBRBTXFBY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|