C13H14O3 — CID 125486133
(2S,6S)-2-hydroxy-6-[(1R)-1-phenylethyl]-2H-pyran-5-one (PubChem CID 125486133) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2S,6S)-2-hydroxy-6-[(1R)-1-phenylethyl]-2H-pyran-5-one.
| Compound Name | (2S,6S)-2-hydroxy-6-[(1R)-1-phenylethyl]-2H-pyran-5-one |
|---|---|
| PubChem CID | 125486133 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (2S,6S)-2-hydroxy-6-[(1R)-1-phenylethyl]-2H-pyran-5-one |
| SMILES | C[C@H](c1ccccc1)[C@@H]1O[C@H](O)C=CC1=O |
| InChI | InChI=1S/C13H14O3/c1-9(10-5-3-2-4-6-10)13-11(14)7-8-12(15)16-13/h2-9,12-13,15H,1H3/t9-,12+,13+/m1/s1 |
| InChIKey | OFSPVQVCKZIIPZ-ICCXJUOJSA-N |
| XLogP | 1.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |