C12H10O3 — CID 101489581
(1S,5S,7S)-7-phenyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one (PubChem CID 101489581) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is (1S,5S,7S)-7-phenyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1S,5S,7S)-7-phenyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 101489581 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (1S,5S,7S)-7-phenyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one |
| SMILES | O=C1C=C[C@@H]2O[C@H]1[C@H](c1ccccc1)O2 |
| InChI | InChI=1S/C12H10O3/c13-9-6-7-10-14-11(12(9)15-10)8-4-2-1-3-5-8/h1-7,10-12H/t10-,11-,12+/m0/s1 |
| InChIKey | MXKPQVNMYTUBAR-SDDRHHMPSA-N |
| XLogP | 1.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |