C18H26OSi — CID 11358148
[(2aS,3S,8bR)-2a,3,4,8b-tetrahydrocyclobuta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11358148) has the molecular formula C18H26OSi and a molecular weight of 286.49 g/mol. Its IUPAC name is [(2aS,3S,8bR)-2a,3,4,8b-tetrahydrocyclobuta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2aS,3S,8bR)-2a,3,4,8b-tetrahydrocyclobuta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11358148 |
| Molecular Formula | C18H26OSi |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [(2aS,3S,8bR)-2a,3,4,8b-tetrahydrocyclobuta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1Cc2ccccc2[C@@H]2C=C[C@H]12 |
| InChI | InChI=1S/C18H26OSi/c1-18(2,3)20(4,5)19-17-12-13-8-6-7-9-14(13)15-10-11-16(15)17/h6-11,15-17H,12H2,1-5H3/t15-,16-,17-/m0/s1 |
| InChIKey | JRFPCJRNIURFMW-ULQDDVLXSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|