C26H34O5Si — CID 10253459
4-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-one (PubChem CID 10253459) has the molecular formula C26H34O5Si and a molecular weight of 454.64 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10253459 |
| Molecular Formula | C26H34O5Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-one |
| SMILES | COc1cc(C2=C(c3ccccc3)C(O[Si](C)(C)C(C)(C)C)CC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H34O5Si/c1-26(2,3)32(7,8)31-20-16-19(27)23(24(20)17-12-10-9-11-13-17)18-14-21(28-4)25(30-6)22(15-18)29-5/h9-15,20H,16H2,1-8H3 |
| InChIKey | BTHXQXWATGNPEV-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|