About CID 58013840
CID 58013840 (PubChem CID 58013840) has the molecular formula C12H23BO2Si
and a molecular weight of 238.21 g/mol.
Molecular Properties
| Compound Name | CID 58013840 |
| PubChem CID | 58013840 |
| Molecular Formula | C12H23BO2Si |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | — |
| SMILES | [B]C1OC(=C)C(O[Si](C)(C)C(C)(C)C)C1C |
| InChI | InChI=1S/C12H23BO2Si/c1-8-10(9(2)14-11(8)13)15-16(6,7)12(3,4)5/h8,10-11H,2H2,1,3-7H3 |
| InChIKey | HFZNCLDTBZPKFQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58013840 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58013840?
The IUPAC name of CID 58013840 (CID 58013840) is not available.
What is the SMILES notation for CID 58013840?
The canonical SMILES for CID 58013840 is [B]C1OC(=C)C(O[Si](C)(C)C(C)(C)C)C1C.
What is the InChIKey of CID 58013840?
The InChIKey is HFZNCLDTBZPKFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23BO2Si/c1-8-10(9(2)14-11(8)13)15-16(6,7)12(3,4)5/h8,10-11H,2H2,1,3-7H3.
What are the key properties of CID 58013840?
CID 58013840 has a molecular weight of 238.21 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58013840 is sourced from PubChem (CID 58013840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).