C12H23BO2Si — CID 58013840
CID 58013840 (PubChem CID 58013840) has the molecular formula C12H23BO2Si and a molecular weight of 238.21 g/mol.
| Compound Name | CID 58013840 |
|---|---|
| PubChem CID | 58013840 |
| Molecular Formula | C12H23BO2Si |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | — |
| SMILES | [B]C1OC(=C)C(O[Si](C)(C)C(C)(C)C)C1C |
| InChI | InChI=1S/C12H23BO2Si/c1-8-10(9(2)14-11(8)13)15-16(6,7)12(3,4)5/h8,10-11H,2H2,1,3-7H3 |
| InChIKey | HFZNCLDTBZPKFQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|