C13H24O3Si — CID 59796127
tert-butyl-[[(1S,2S,3S,5S)-2-methoxy-4-methylidene-6-oxabicyclo[3.1.0]hexan-3-yl]oxy]-dimethylsilane (PubChem CID 59796127) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,3S,5S)-2-methoxy-4-methylidene-6-oxabicyclo[3.1.0]hexan-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S,3S,5S)-2-methoxy-4-methylidene-6-oxabicyclo[3.1.0]hexan-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 59796127 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | tert-butyl-[[(1S,2S,3S,5S)-2-methoxy-4-methylidene-6-oxabicyclo[3.1.0]hexan-3-yl]oxy]-dimethylsilane |
| SMILES | C=C1[C@@H]2O[C@@H]2[C@H](OC)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H24O3Si/c1-8-9-12(15-9)11(14-5)10(8)16-17(6,7)13(2,3)4/h9-12H,1H2,2-7H3/t9-,10-,11+,12-/m0/s1 |
| InChIKey | FSJHLJQJECYRKW-YFKTTZPYSA-N |
| XLogP | 2.73 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|