C16H31NO4Si — CID 134836934
(2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-[(Z)-N-methoxy-C-methylcarbonimidoyl]cyclohexan-1-one (PubChem CID 134836934) has the molecular formula C16H31NO4Si and a molecular weight of 329.51 g/mol. Its IUPAC name is (2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-[(Z)-N-methoxy-C-methylcarbonimidoyl]cyclohexan-1-one.
| Compound Name | (2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-[(Z)-N-methoxy-C-methylcarbonimidoyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 134836934 |
| Molecular Formula | C16H31NO4Si |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-[(Z)-N-methoxy-C-methylcarbonimidoyl]cyclohexan-1-one |
| SMILES | CO/N=C(/C)[C@H]1CCC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC |
| InChI | InChI=1S/C16H31NO4Si/c1-11(17-20-6)12-9-10-13(18)15(14(12)19-5)21-22(7,8)16(2,3)4/h12,14-15H,9-10H2,1-8H3/b17-11-/t12-,14-,15+/m1/s1 |
| InChIKey | AEQXXJUJFOYYAC-WKWFBXPOSA-N |
| XLogP | 3.39 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|