C19H39NO4Si2 — CID 134836943
(Z)-1-[(1R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-4-trimethylsilyloxycyclohex-3-en-1-yl]-N-methoxyethanimine (PubChem CID 134836943) has the molecular formula C19H39NO4Si2 and a molecular weight of 401.70 g/mol. Its IUPAC name is (Z)-1-[(1R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-4-trimethylsilyloxycyclohex-3-en-1-yl]-N-methoxyethanimine.
| Compound Name | (Z)-1-[(1R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-4-trimethylsilyloxycyclohex-3-en-1-yl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 134836943 |
| Molecular Formula | C19H39NO4Si2 |
| Molecular Weight | 401.70 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (Z)-1-[(1R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-4-trimethylsilyloxycyclohex-3-en-1-yl]-N-methoxyethanimine |
| SMILES | CO/N=C(/C)[C@H]1CC=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC |
| InChI | InChI=1S/C19H39NO4Si2/c1-14(20-22-6)15-12-13-16(23-25(7,8)9)18(17(15)21-5)24-26(10,11)19(2,3)4/h13,15,17-18H,12H2,1-11H3/b20-14-/t15-,17-,18-/m1/s1 |
| InChIKey | VTKHFJRDDOSHNU-KUVDVUPZSA-N |
| XLogP | 5.17 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.70 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|