C24H51BrO4Si3 — CID 11060812
(1S,2S,5S,6S)-3-bromo-2,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-3-en-1-ol (PubChem CID 11060812) has the molecular formula C24H51BrO4Si3 and a molecular weight of 567.83 g/mol. Its IUPAC name is (1S,2S,5S,6S)-3-bromo-2,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-3-en-1-ol.
| Compound Name | (1S,2S,5S,6S)-3-bromo-2,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 11060812 |
| Molecular Formula | C24H51BrO4Si3 |
| Molecular Weight | 567.83 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | (1S,2S,5S,6S)-3-bromo-2,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-3-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C(Br)=C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H51BrO4Si3/c1-22(2,3)30(10,11)27-18-16-17(25)20(28-31(12,13)23(4,5)6)19(26)21(18)29-32(14,15)24(7,8)9/h16,18-21,26H,1-15H3/t18-,19+,20+,21+/m0/s1 |
| InChIKey | LPCDHSNIHKHEPS-DOIPELPJSA-N |
| XLogP | 7.81 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.83 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|