C15H25BrO4Si — CID 11222641
[(1'R,2'S,6'S)-4'-bromospiro[1,3-dioxane-2,5'-7-oxabicyclo[4.1.0]hept-3-ene]-2'-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11222641) has the molecular formula C15H25BrO4Si and a molecular weight of 377.35 g/mol. Its IUPAC name is [(1'R,2'S,6'S)-4'-bromospiro[1,3-dioxane-2,5'-7-oxabicyclo[4.1.0]hept-3-ene]-2'-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1'R,2'S,6'S)-4'-bromospiro[1,3-dioxane-2,5'-7-oxabicyclo[4.1.0]hept-3-ene]-2'-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11222641 |
| Molecular Formula | C15H25BrO4Si |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [(1'R,2'S,6'S)-4'-bromospiro[1,3-dioxane-2,5'-7-oxabicyclo[4.1.0]hept-3-ene]-2'-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C(Br)C2(OCCCO2)[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C15H25BrO4Si/c1-14(2,3)21(4,5)20-10-9-11(16)15(13-12(10)19-13)17-7-6-8-18-15/h9-10,12-13H,6-8H2,1-5H3/t10-,12-,13-/m0/s1 |
| InChIKey | HYUVZEDHGBUSLC-DRZSPHRISA-N |
| XLogP | 3.57 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|