C13H21F3O6SSi — CID 11728864
[(1S,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7-oxabicyclo[4.1.0]hept-2-en-2-yl] trifluoromethanesulfonate (PubChem CID 11728864) has the molecular formula C13H21F3O6SSi and a molecular weight of 390.45 g/mol. Its IUPAC name is [(1S,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7-oxabicyclo[4.1.0]hept-2-en-2-yl] trifluoromethanesulfonate.
| Compound Name | [(1S,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7-oxabicyclo[4.1.0]hept-2-en-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11728864 |
| Molecular Formula | C13H21F3O6SSi |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | [(1S,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7-oxabicyclo[4.1.0]hept-2-en-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C(OS(=O)(=O)C(F)(F)F)[C@H]2O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C13H21F3O6SSi/c1-12(2,3)24(4,5)22-7-6-8(10-11(20-10)9(7)17)21-23(18,19)13(14,15)16/h6-7,9-11,17H,1-5H3/t7-,9+,10+,11-/m0/s1 |
| InChIKey | GFJKODZWRBPARS-IANFPDNMSA-N |
| XLogP | 2.27 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|